C21H26N2O5 — CID 170869301
4-[3-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]propyl]morpholine (PubChem CID 170869301) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-[3-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]propyl]morpholine.
| Compound Name | 4-[3-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]propyl]morpholine |
|---|---|
| PubChem CID | 170869301 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-[3-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]propyl]morpholine |
| SMILES | COc1cc(CCCN2CCOCC2)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-26-21-15-17(3-2-10-22-11-13-27-14-12-22)6-9-20(21)28-16-18-4-7-19(8-5-18)23(24)25/h4-9,15H,2-3,10-14,16H2,1H3 |
| InChIKey | OUENFGUADVVUSF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|