C21H35N3O3 — CID 170863583
4-[2-[2-methoxy-5-[3-(4-methylpiperazin-1-yl)propyl]phenoxy]ethyl]morpholine (PubChem CID 170863583) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is 4-[2-[2-methoxy-5-[3-(4-methylpiperazin-1-yl)propyl]phenoxy]ethyl]morpholine.
| Compound Name | 4-[2-[2-methoxy-5-[3-(4-methylpiperazin-1-yl)propyl]phenoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 170863583 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 4-[2-[2-methoxy-5-[3-(4-methylpiperazin-1-yl)propyl]phenoxy]ethyl]morpholine |
| SMILES | COc1ccc(CCCN2CCN(C)CC2)cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C21H35N3O3/c1-22-8-10-23(11-9-22)7-3-4-19-5-6-20(25-2)21(18-19)27-17-14-24-12-15-26-16-13-24/h5-6,18H,3-4,7-17H2,1-2H3 |
| InChIKey | HCAVKNRNAKDLLE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |