C18H30ClNO3 — CID 2993564
4-[4-(2-methoxy-4-propylphenoxy)butyl]morpholine;hydrochloride (PubChem CID 2993564) has the molecular formula C18H30ClNO3 and a molecular weight of 343.90 g/mol. Its IUPAC name is 4-[4-(2-methoxy-4-propylphenoxy)butyl]morpholine;hydrochloride.
| Compound Name | 4-[4-(2-methoxy-4-propylphenoxy)butyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 2993564 |
| Molecular Formula | C18H30ClNO3 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 4-[4-(2-methoxy-4-propylphenoxy)butyl]morpholine;hydrochloride |
| SMILES | CCCc1ccc(OCCCCN2CCOCC2)c(OC)c1.Cl |
| InChI | InChI=1S/C18H29NO3.ClH/c1-3-6-16-7-8-17(18(15-16)20-2)22-12-5-4-9-19-10-13-21-14-11-19;/h7-8,15H,3-6,9-14H2,1-2H3;1H |
| InChIKey | GGYXKCNGGOLFFT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|