C21H26ClN3O5 — CID 66537283
N-[[2-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine (PubChem CID 66537283) has the molecular formula C21H26ClN3O5 and a molecular weight of 435.91 g/mol. Its IUPAC name is N-[[2-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine.
| Compound Name | N-[[2-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 66537283 |
| Molecular Formula | C21H26ClN3O5 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[[2-chloro-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methyl]-2-morpholin-4-ylethanamine |
| SMILES | COc1cc(CNCCN2CCOCC2)c(Cl)cc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H26ClN3O5/c1-28-20-12-17(14-23-6-7-24-8-10-29-11-9-24)19(22)13-21(20)30-15-16-2-4-18(5-3-16)25(26)27/h2-5,12-13,23H,6-11,14-15H2,1H3 |
| InChIKey | TYRYLEPQCSDKHC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|