C44H70N4O8 — CID 58000804
3-[3-[5-[4-[3,4-bis(3-morpholin-4-ylpropoxy)phenyl]butyl]-2-(3-morpholin-4-ylpropoxy)phenoxy]propyl]-1,3-oxazinane (PubChem CID 58000804) has the molecular formula C44H70N4O8 and a molecular weight of 783.06 g/mol. Its IUPAC name is 3-[3-[5-[4-[3,4-bis(3-morpholin-4-ylpropoxy)phenyl]butyl]-2-(3-morpholin-4-ylpropoxy)phenoxy]propyl]-1,3-oxazinane.
| Compound Name | 3-[3-[5-[4-[3,4-bis(3-morpholin-4-ylpropoxy)phenyl]butyl]-2-(3-morpholin-4-ylpropoxy)phenoxy]propyl]-1,3-oxazinane |
|---|---|
| PubChem CID | 58000804 |
| Molecular Formula | C44H70N4O8 |
| Molecular Weight | 783.06 g/mol |
| Exact Mass | 782.52 |
| IUPAC Name | 3-[3-[5-[4-[3,4-bis(3-morpholin-4-ylpropoxy)phenyl]butyl]-2-(3-morpholin-4-ylpropoxy)phenoxy]propyl]-1,3-oxazinane |
| SMILES | c1cc(OCCCN2CCOCC2)c(OCCCN2CCOCC2)cc1CCCCc1ccc(OCCCN2CCOCC2)c(OCCCN2CCCOC2)c1 |
| InChI | InChI=1S/C44H70N4O8/c1(8-39-10-12-41(53-26-4-14-45-19-30-49-31-20-45)43(36-39)55-28-6-16-47-23-34-51-35-24-47)2-9-40-11-13-42(54-27-5-15-46-21-32-50-33-22-46)44(37-40)56-29-7-18-48-17-3-25-52-38-48/h10-13,36-37H,1-9,14-35,38H2 |
| InChIKey | MYYMUGOBUOGYJR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 86.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.06 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|