C16H17F3N2O2 — CID 177027614
1-methyl-6-(morpholin-4-ylmethyl)-4-(trifluoromethyl)quinolin-2-one (PubChem CID 177027614) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is 1-methyl-6-(morpholin-4-ylmethyl)-4-(trifluoromethyl)quinolin-2-one.
| Compound Name | 1-methyl-6-(morpholin-4-ylmethyl)-4-(trifluoromethyl)quinolin-2-one |
|---|---|
| PubChem CID | 177027614 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-methyl-6-(morpholin-4-ylmethyl)-4-(trifluoromethyl)quinolin-2-one |
| SMILES | Cn1c(=O)cc(C(F)(F)F)c2cc(CN3CCOCC3)ccc21 |
| InChI | InChI=1S/C16H17F3N2O2/c1-20-14-3-2-11(10-21-4-6-23-7-5-21)8-12(14)13(9-15(20)22)16(17,18)19/h2-3,8-9H,4-7,10H2,1H3 |
| InChIKey | BSZZQHZFRGLWPF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |