C19H20F4N2O — CID 138384991
4-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one (PubChem CID 138384991) has the molecular formula C19H20F4N2O and a molecular weight of 368.37 g/mol. Its IUPAC name is 4-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one.
| Compound Name | 4-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 138384991 |
| Molecular Formula | C19H20F4N2O |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 4-[1-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one |
| SMILES | Cn1ccc(C2CCN(Cc3ccc(C(F)(F)F)c(F)c3)CC2)cc1=O |
| InChI | InChI=1S/C19H20F4N2O/c1-24-7-4-15(11-18(24)26)14-5-8-25(9-6-14)12-13-2-3-16(17(20)10-13)19(21,22)23/h2-4,7,10-11,14H,5-6,8-9,12H2,1H3 |
| InChIKey | HGKPJHLNIPPHTK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |