C18H19F3N2O — CID 138386123
1-methyl-4-[1-[(2,3,6-trifluorophenyl)methyl]piperidin-4-yl]pyridin-2-one (PubChem CID 138386123) has the molecular formula C18H19F3N2O and a molecular weight of 336.36 g/mol. Its IUPAC name is 1-methyl-4-[1-[(2,3,6-trifluorophenyl)methyl]piperidin-4-yl]pyridin-2-one.
| Compound Name | 1-methyl-4-[1-[(2,3,6-trifluorophenyl)methyl]piperidin-4-yl]pyridin-2-one |
|---|---|
| PubChem CID | 138386123 |
| Molecular Formula | C18H19F3N2O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-methyl-4-[1-[(2,3,6-trifluorophenyl)methyl]piperidin-4-yl]pyridin-2-one |
| SMILES | Cn1ccc(C2CCN(Cc3c(F)ccc(F)c3F)CC2)cc1=O |
| InChI | InChI=1S/C18H19F3N2O/c1-22-7-4-13(10-17(22)24)12-5-8-23(9-6-12)11-14-15(19)2-3-16(20)18(14)21/h2-4,7,10,12H,5-6,8-9,11H2,1H3 |
| InChIKey | YQEBHQRBJKDMGP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|