C26H28F2N4O2 — CID 25253401
4-[1-[[5-[(E)-C-(3,4-difluorophenyl)-N-ethoxycarbonimidoyl]-2-pyridinyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one (PubChem CID 25253401) has the molecular formula C26H28F2N4O2 and a molecular weight of 466.53 g/mol. Its IUPAC name is 4-[1-[[5-[(E)-C-(3,4-difluorophenyl)-N-ethoxycarbonimidoyl]-2-pyridinyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one.
| Compound Name | 4-[1-[[5-[(E)-C-(3,4-difluorophenyl)-N-ethoxycarbonimidoyl]-2-pyridinyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 25253401 |
| Molecular Formula | C26H28F2N4O2 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 4-[1-[[5-[(E)-C-(3,4-difluorophenyl)-N-ethoxycarbonimidoyl]-2-pyridinyl]methyl]piperidin-4-yl]-1-methylpyridin-2-one |
| SMILES | CCO/N=C(/c1ccc(CN2CCC(c3ccn(C)c(=O)c3)CC2)nc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C26H28F2N4O2/c1-3-34-30-26(20-5-7-23(27)24(28)14-20)21-4-6-22(29-16-21)17-32-12-9-18(10-13-32)19-8-11-31(2)25(33)15-19/h4-8,11,14-16,18H,3,9-10,12-13,17H2,1-2H3/b30-26+ |
| InChIKey | SFQJYPKEHYCQCS-URGPHPNLSA-N |
| XLogP | 4.23 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|