C27H31N3O5 — CID 174452435
[6-(morpholin-4-ylmethyl)-1-(4-morpholin-4-ylphenyl)-4-oxoquinolin-3-yl] propanoate (PubChem CID 174452435) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is [6-(morpholin-4-ylmethyl)-1-(4-morpholin-4-ylphenyl)-4-oxoquinolin-3-yl] propanoate.
| Compound Name | [6-(morpholin-4-ylmethyl)-1-(4-morpholin-4-ylphenyl)-4-oxoquinolin-3-yl] propanoate |
|---|---|
| PubChem CID | 174452435 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | [6-(morpholin-4-ylmethyl)-1-(4-morpholin-4-ylphenyl)-4-oxoquinolin-3-yl] propanoate |
| SMILES | CCC(=O)Oc1cn(-c2ccc(N3CCOCC3)cc2)c2ccc(CN3CCOCC3)cc2c1=O |
| InChI | InChI=1S/C27H31N3O5/c1-2-26(31)35-25-19-30(22-6-4-21(5-7-22)29-11-15-34-16-12-29)24-8-3-20(17-23(24)27(25)32)18-28-9-13-33-14-10-28/h3-8,17,19H,2,9-16,18H2,1H3 |
| InChIKey | LDEPYWJPFTXRPU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 73.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|