C32H34ClN3O4 — CID 5277731
N-[(4-chlorophenyl)methyl]-1-[3-(4-hydroxybutyl)phenyl]-6-(morpholin-4-ylmethyl)-4-oxoquinoline-3-carboxamide (PubChem CID 5277731) has the molecular formula C32H34ClN3O4 and a molecular weight of 560.09 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-[3-(4-hydroxybutyl)phenyl]-6-(morpholin-4-ylmethyl)-4-oxoquinoline-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-[3-(4-hydroxybutyl)phenyl]-6-(morpholin-4-ylmethyl)-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 5277731 |
| Molecular Formula | C32H34ClN3O4 |
| Molecular Weight | 560.09 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-[3-(4-hydroxybutyl)phenyl]-6-(morpholin-4-ylmethyl)-4-oxoquinoline-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1cn(-c2cccc(CCCCO)c2)c2ccc(CN3CCOCC3)cc2c1=O |
| InChI | InChI=1S/C32H34ClN3O4/c33-26-10-7-24(8-11-26)20-34-32(39)29-22-36(27-6-3-5-23(18-27)4-1-2-15-37)30-12-9-25(19-28(30)31(29)38)21-35-13-16-40-17-14-35/h3,5-12,18-19,22,37H,1-2,4,13-17,20-21H2,(H,34,39) |
| InChIKey | ZALLPCNULVCPCR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.09 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|