C28H30ClN3O4 — CID 5278415
N-[(4-chlorophenyl)methyl]-8-(5-hydroxypent-1-ynyl)-1-methyl-6-(morpholin-4-ylmethyl)-4-oxoquinoline-3-carboxamide (PubChem CID 5278415) has the molecular formula C28H30ClN3O4 and a molecular weight of 508.02 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-8-(5-hydroxypent-1-ynyl)-1-methyl-6-(morpholin-4-ylmethyl)-4-oxoquinoline-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-8-(5-hydroxypent-1-ynyl)-1-methyl-6-(morpholin-4-ylmethyl)-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 5278415 |
| Molecular Formula | C28H30ClN3O4 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-8-(5-hydroxypent-1-ynyl)-1-methyl-6-(morpholin-4-ylmethyl)-4-oxoquinoline-3-carboxamide |
| SMILES | Cn1cc(C(=O)NCc2ccc(Cl)cc2)c(=O)c2cc(CN3CCOCC3)cc(C#CCCCO)c21 |
| InChI | InChI=1S/C28H30ClN3O4/c1-31-19-25(28(35)30-17-20-6-8-23(29)9-7-20)27(34)24-16-21(18-32-10-13-36-14-11-32)15-22(26(24)31)5-3-2-4-12-33/h6-9,15-16,19,33H,2,4,10-14,17-18H2,1H3,(H,30,35) |
| InChIKey | FNALQGUDHPRRGW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|