C26H27ClN4O4 — CID 10206909
N-[(4-chlorophenyl)methyl]-8-(5-hydroxypent-1-ynyl)-6-(morpholin-4-ylmethyl)-4-oxo-1H-cinnoline-3-carboxamide (PubChem CID 10206909) has the molecular formula C26H27ClN4O4 and a molecular weight of 494.98 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-8-(5-hydroxypent-1-ynyl)-6-(morpholin-4-ylmethyl)-4-oxo-1H-cinnoline-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-8-(5-hydroxypent-1-ynyl)-6-(morpholin-4-ylmethyl)-4-oxo-1H-cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 10206909 |
| Molecular Formula | C26H27ClN4O4 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-8-(5-hydroxypent-1-ynyl)-6-(morpholin-4-ylmethyl)-4-oxo-1H-cinnoline-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1n[nH]c2c(C#CCCCO)cc(CN3CCOCC3)cc2c1=O |
| InChI | InChI=1S/C26H27ClN4O4/c27-21-7-5-18(6-8-21)16-28-26(34)24-25(33)22-15-19(17-31-9-12-35-13-10-31)14-20(23(22)29-30-24)4-2-1-3-11-32/h5-8,14-15,32H,1,3,9-13,16-17H2,(H,28,34)(H,29,33) |
| InChIKey | GUAKFLFCKGHMRG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|