C25H24ClN3O4 — CID 10183391
N-[(4-chlorophenyl)methyl]-8-(4-hydroxybut-1-ynyl)-6-(oxan-4-yl)-4-oxo-1H-cinnoline-3-carboxamide (PubChem CID 10183391) has the molecular formula C25H24ClN3O4 and a molecular weight of 465.94 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-8-(4-hydroxybut-1-ynyl)-6-(oxan-4-yl)-4-oxo-1H-cinnoline-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-8-(4-hydroxybut-1-ynyl)-6-(oxan-4-yl)-4-oxo-1H-cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 10183391 |
| Molecular Formula | C25H24ClN3O4 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-8-(4-hydroxybut-1-ynyl)-6-(oxan-4-yl)-4-oxo-1H-cinnoline-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1n[nH]c2c(C#CCCO)cc(C3CCOCC3)cc2c1=O |
| InChI | InChI=1S/C25H24ClN3O4/c26-20-6-4-16(5-7-20)15-27-25(32)23-24(31)21-14-19(17-8-11-33-12-9-17)13-18(3-1-2-10-30)22(21)28-29-23/h4-7,13-14,17,30H,2,8-12,15H2,(H,27,32)(H,28,31) |
| InChIKey | PKIIEFVROBJEIN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|