C20H17F2N3O5 — CID 67757356
[1-(4-aminophenyl)-6,8-difluoro-7-morpholin-4-yl-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 67757356) has the molecular formula C20H17F2N3O5 and a molecular weight of 417.37 g/mol. Its IUPAC name is [1-(4-aminophenyl)-6,8-difluoro-7-morpholin-4-yl-4-oxoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [1-(4-aminophenyl)-6,8-difluoro-7-morpholin-4-yl-4-oxoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67757356 |
| Molecular Formula | C20H17F2N3O5 |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [1-(4-aminophenyl)-6,8-difluoro-7-morpholin-4-yl-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | Nc1ccc(-n2cc(OC(=O)O)c(=O)c3cc(F)c(N4CCOCC4)c(F)c32)cc1 |
| InChI | InChI=1S/C20H17F2N3O5/c21-14-9-13-17(16(22)18(14)24-5-7-29-8-6-24)25(12-3-1-11(23)2-4-12)10-15(19(13)26)30-20(27)28/h1-4,9-10H,5-8,23H2,(H,27,28) |
| InChIKey | RCUWFQYHXABZOK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|