C16H7ClF3NO4 — CID 70470947
[1-(4-chlorophenyl)-6,7,8-trifluoro-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 70470947) has the molecular formula C16H7ClF3NO4 and a molecular weight of 369.68 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-6,7,8-trifluoro-4-oxoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [1-(4-chlorophenyl)-6,7,8-trifluoro-4-oxoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70470947 |
| Molecular Formula | C16H7ClF3NO4 |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | [1-(4-chlorophenyl)-6,7,8-trifluoro-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cn(-c2ccc(Cl)cc2)c2c(F)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C16H7ClF3NO4/c17-7-1-3-8(4-2-7)21-6-11(25-16(23)24)15(22)9-5-10(18)12(19)13(20)14(9)21/h1-6H,(H,23,24) |
| InChIKey | HZFAOYFJMCNPMX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|