C13H10F2N2O4 — CID 70448131
(7-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl) hydrogen carbonate (PubChem CID 70448131) has the molecular formula C13H10F2N2O4 and a molecular weight of 296.23 g/mol. Its IUPAC name is (7-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl) hydrogen carbonate.
| Compound Name | (7-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 70448131 |
| Molecular Formula | C13H10F2N2O4 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (7-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl) hydrogen carbonate |
| SMILES | Nc1c(F)cc2c(=O)c(OC(=O)O)cn(C3CC3)c2c1F |
| InChI | InChI=1S/C13H10F2N2O4/c14-7-3-6-11(9(15)10(7)16)17(5-1-2-5)4-8(12(6)18)21-13(19)20/h3-5H,1-2,16H2,(H,19,20) |
| InChIKey | ZXPDMNZDQFEHIO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|