C19H20ClF2N3O5 — CID 67553109
[7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl] hydrogen carbonate;hydrochloride (PubChem CID 67553109) has the molecular formula C19H20ClF2N3O5 and a molecular weight of 443.83 g/mol. Its IUPAC name is [7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl] hydrogen carbonate;hydrochloride.
| Compound Name | [7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl] hydrogen carbonate;hydrochloride |
|---|---|
| PubChem CID | 67553109 |
| Molecular Formula | C19H20ClF2N3O5 |
| Molecular Weight | 443.83 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | [7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl] hydrogen carbonate;hydrochloride |
| SMILES | Cl.O=C(O)Oc1cn(C2CC2)c2c(F)c(N3C[C@@H]4OCCN[C@@H]4C3)c(F)cc2c1=O |
| InChI | InChI=1S/C19H19F2N3O5.ClH/c20-11-5-10-16(24(9-1-2-9)8-14(18(10)25)29-19(26)27)15(21)17(11)23-6-12-13(7-23)28-4-3-22-12;/h5,8-9,12-13,22H,1-4,6-7H2,(H,26,27);1H/t12-,13+;/m1./s1 |
| InChIKey | GWWUPTLJWLDHRU-KZCZEQIWSA-N |
| XLogP | 2.27 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.83 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |