C21H20FN3O4 — CID 22857290
7-[(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-8-ethynyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 22857290) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is 7-[(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-8-ethynyl-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-8-ethynyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22857290 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 7-[(4aS,7aR)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-8-ethynyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | C#Cc1c(N2C[C@@H]3NCCO[C@@H]3C2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C21H20FN3O4/c1-2-12-18-13(20(26)14(21(27)28)8-25(18)11-3-4-11)7-15(22)19(12)24-9-16-17(10-24)29-6-5-23-16/h1,7-8,11,16-17,23H,3-6,9-10H2,(H,27,28)/t16-,17+/m0/s1 |
| InChIKey | WFBBRNHULOHRAB-DLBZAZTESA-N |
| XLogP | 1.33 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|