C19H19F2N3O4 — CID 57324823
7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 57324823) has the molecular formula C19H19F2N3O4 and a molecular weight of 391.37 g/mol. Its IUPAC name is 7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 57324823 |
| Molecular Formula | C19H19F2N3O4 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-1-cyclopropyl-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2c(F)c(N3C[C@@H]4OCCN[C@@H]4C3)c(F)cc2c1=O |
| InChI | InChI=1S/C19H19F2N3O4/c20-12-5-10-16(24(9-1-2-9)6-11(18(10)25)19(26)27)15(21)17(12)23-7-13-14(8-23)28-4-3-22-13/h5-6,9,13-14,22H,1-4,7-8H2,(H,26,27)/t13-,14+/m1/s1 |
| InChIKey | KJMDWKUAJVIUFV-KGLIPLIRSA-N |
| XLogP | 1.49 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |