C19H20F2N4O5 — CID 67845363
[7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-5-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 67845363) has the molecular formula C19H20F2N4O5 and a molecular weight of 422.39 g/mol. Its IUPAC name is [7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-5-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-5-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67845363 |
| Molecular Formula | C19H20F2N4O5 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [7-[(4aR,7aS)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-6-yl]-5-amino-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | Nc1c(F)c(N2C[C@@H]3OCCN[C@@H]3C2)c(F)c2c1c(=O)c(OC(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C19H20F2N4O5/c20-13-15(22)12-16(25(8-1-2-8)7-11(18(12)26)30-19(27)28)14(21)17(13)24-5-9-10(6-24)29-4-3-23-9/h7-10,23H,1-6,22H2,(H,27,28)/t9-,10+/m1/s1 |
| InChIKey | WYAWFUQLIXPOKQ-ZJUUUORDSA-N |
| XLogP | 1.43 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|