C17H19FN4O5 — CID 67906277
[5-amino-7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-hydroxy-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 67906277) has the molecular formula C17H19FN4O5 and a molecular weight of 378.36 g/mol. Its IUPAC name is [5-amino-7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-hydroxy-4-oxoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [5-amino-7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-hydroxy-4-oxoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67906277 |
| Molecular Formula | C17H19FN4O5 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [5-amino-7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-hydroxy-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | Nc1c(F)c(N2CCC(N)C2)c(O)c2c1c(=O)c(OC(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C17H19FN4O5/c18-11-12(20)10-13(16(24)14(11)21-4-3-7(19)5-21)22(8-1-2-8)6-9(15(10)23)27-17(25)26/h6-8,24H,1-5,19-20H2,(H,25,26) |
| InChIKey | NJSSJUCHXUMSJR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 144.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|