C23H22F2N4O4 — CID 70418833
[5-amino-1-cyclopropyl-6,8-difluoro-4-oxo-7-(3-phenylpiperazin-1-yl)quinolin-3-yl] hydrogen carbonate (PubChem CID 70418833) has the molecular formula C23H22F2N4O4 and a molecular weight of 456.45 g/mol. Its IUPAC name is [5-amino-1-cyclopropyl-6,8-difluoro-4-oxo-7-(3-phenylpiperazin-1-yl)quinolin-3-yl] hydrogen carbonate.
| Compound Name | [5-amino-1-cyclopropyl-6,8-difluoro-4-oxo-7-(3-phenylpiperazin-1-yl)quinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70418833 |
| Molecular Formula | C23H22F2N4O4 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | [5-amino-1-cyclopropyl-6,8-difluoro-4-oxo-7-(3-phenylpiperazin-1-yl)quinolin-3-yl] hydrogen carbonate |
| SMILES | Nc1c(F)c(N2CCNC(c3ccccc3)C2)c(F)c2c1c(=O)c(OC(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C23H22F2N4O4/c24-17-19(26)16-20(29(13-6-7-13)11-15(22(16)30)33-23(31)32)18(25)21(17)28-9-8-27-14(10-28)12-4-2-1-3-5-12/h1-5,11,13-14,27H,6-10,26H2,(H,31,32) |
| InChIKey | IWRPFUBWTUCLIX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|