C13H11ClFN3O4 — CID 70462754
(6-chloro-1-cyclopropyl-8-fluoro-7-hydrazinyl-4-oxoquinolin-3-yl) hydrogen carbonate (PubChem CID 70462754) has the molecular formula C13H11ClFN3O4 and a molecular weight of 327.70 g/mol. Its IUPAC name is (6-chloro-1-cyclopropyl-8-fluoro-7-hydrazinyl-4-oxoquinolin-3-yl) hydrogen carbonate.
| Compound Name | (6-chloro-1-cyclopropyl-8-fluoro-7-hydrazinyl-4-oxoquinolin-3-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 70462754 |
| Molecular Formula | C13H11ClFN3O4 |
| Molecular Weight | 327.70 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | (6-chloro-1-cyclopropyl-8-fluoro-7-hydrazinyl-4-oxoquinolin-3-yl) hydrogen carbonate |
| SMILES | NNc1c(Cl)cc2c(=O)c(OC(=O)O)cn(C3CC3)c2c1F |
| InChI | InChI=1S/C13H11ClFN3O4/c14-7-3-6-11(9(15)10(7)17-16)18(5-1-2-5)4-8(12(6)19)22-13(20)21/h3-5,17H,1-2,16H2,(H,20,21) |
| InChIKey | PVTRFNSZURWRJQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.70 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|