C13H9ClN2O6 — CID 70458067
(6-chloro-1-cyclopropyl-7-nitro-4-oxoquinolin-3-yl) hydrogen carbonate (PubChem CID 70458067) has the molecular formula C13H9ClN2O6 and a molecular weight of 324.68 g/mol. Its IUPAC name is (6-chloro-1-cyclopropyl-7-nitro-4-oxoquinolin-3-yl) hydrogen carbonate.
| Compound Name | (6-chloro-1-cyclopropyl-7-nitro-4-oxoquinolin-3-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 70458067 |
| Molecular Formula | C13H9ClN2O6 |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | (6-chloro-1-cyclopropyl-7-nitro-4-oxoquinolin-3-yl) hydrogen carbonate |
| SMILES | O=C(O)Oc1cn(C2CC2)c2cc([N+](=O)[O-])c(Cl)cc2c1=O |
| InChI | InChI=1S/C13H9ClN2O6/c14-8-3-7-9(4-10(8)16(20)21)15(6-1-2-6)5-11(12(7)17)22-13(18)19/h3-6H,1-2H2,(H,18,19) |
| InChIKey | ZEVSTUUELDTWDM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|