C13H11N3O6 — CID 70462883
(7-amino-1-cyclopropyl-6-nitro-4-oxoquinolin-3-yl) hydrogen carbonate (PubChem CID 70462883) has the molecular formula C13H11N3O6 and a molecular weight of 305.25 g/mol. Its IUPAC name is (7-amino-1-cyclopropyl-6-nitro-4-oxoquinolin-3-yl) hydrogen carbonate.
| Compound Name | (7-amino-1-cyclopropyl-6-nitro-4-oxoquinolin-3-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 70462883 |
| Molecular Formula | C13H11N3O6 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (7-amino-1-cyclopropyl-6-nitro-4-oxoquinolin-3-yl) hydrogen carbonate |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])c(=O)c(OC(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C13H11N3O6/c14-8-4-9-7(3-10(8)16(20)21)12(17)11(22-13(18)19)5-15(9)6-1-2-6/h3-6H,1-2,14H2,(H,18,19) |
| InChIKey | GEGJAXVJPGPZMO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|