C13H8ClF2NO4 — CID 67847636
(5-chloro-1-cyclopropyl-7,8-difluoro-4-oxoquinolin-3-yl) hydrogen carbonate (PubChem CID 67847636) has the molecular formula C13H8ClF2NO4 and a molecular weight of 315.66 g/mol. Its IUPAC name is (5-chloro-1-cyclopropyl-7,8-difluoro-4-oxoquinolin-3-yl) hydrogen carbonate.
| Compound Name | (5-chloro-1-cyclopropyl-7,8-difluoro-4-oxoquinolin-3-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 67847636 |
| Molecular Formula | C13H8ClF2NO4 |
| Molecular Weight | 315.66 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | (5-chloro-1-cyclopropyl-7,8-difluoro-4-oxoquinolin-3-yl) hydrogen carbonate |
| SMILES | O=C(O)Oc1cn(C2CC2)c2c(F)c(F)cc(Cl)c2c1=O |
| InChI | InChI=1S/C13H8ClF2NO4/c14-6-3-7(15)10(16)11-9(6)12(18)8(21-13(19)20)4-17(11)5-1-2-5/h3-5H,1-2H2,(H,19,20) |
| InChIKey | ZVKKIVPBXYLPGI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.66 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|