C22H23F2N3O4 — CID 22364250
[1-cyclopropyl-5-ethenyl-6,8-difluoro-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 22364250) has the molecular formula C22H23F2N3O4 and a molecular weight of 431.44 g/mol. Its IUPAC name is [1-cyclopropyl-5-ethenyl-6,8-difluoro-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-4-oxoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [1-cyclopropyl-5-ethenyl-6,8-difluoro-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-4-oxoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 22364250 |
| Molecular Formula | C22H23F2N3O4 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | [1-cyclopropyl-5-ethenyl-6,8-difluoro-7-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | C=Cc1c(F)c(N2CC3CN(C)CC3C2)c(F)c2c1c(=O)c(OC(=O)O)cn2C1CC1 |
| InChI | InChI=1S/C22H23F2N3O4/c1-3-14-16-19(27(13-4-5-13)10-15(21(16)28)31-22(29)30)18(24)20(17(14)23)26-8-11-6-25(2)7-12(11)9-26/h3,10-13H,1,4-9H2,2H3,(H,29,30) |
| InChIKey | OVEPRHXZKRUQBQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |