C21H22F3N3O5 — CID 70418123
[1-cyclopropyl-5,6,8-trifluoro-4-oxo-7-[4-(3-oxobutyl)piperazin-1-yl]quinolin-3-yl] hydrogen carbonate (PubChem CID 70418123) has the molecular formula C21H22F3N3O5 and a molecular weight of 453.42 g/mol. Its IUPAC name is [1-cyclopropyl-5,6,8-trifluoro-4-oxo-7-[4-(3-oxobutyl)piperazin-1-yl]quinolin-3-yl] hydrogen carbonate.
| Compound Name | [1-cyclopropyl-5,6,8-trifluoro-4-oxo-7-[4-(3-oxobutyl)piperazin-1-yl]quinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70418123 |
| Molecular Formula | C21H22F3N3O5 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [1-cyclopropyl-5,6,8-trifluoro-4-oxo-7-[4-(3-oxobutyl)piperazin-1-yl]quinolin-3-yl] hydrogen carbonate |
| SMILES | CC(=O)CCN1CCN(c2c(F)c(F)c3c(=O)c(OC(=O)O)cn(C4CC4)c3c2F)CC1 |
| InChI | InChI=1S/C21H22F3N3O5/c1-11(28)4-5-25-6-8-26(9-7-25)19-16(23)15(22)14-18(17(19)24)27(12-2-3-12)10-13(20(14)29)32-21(30)31/h10,12H,2-9H2,1H3,(H,30,31) |
| InChIKey | MNEMARCXASHHNT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|