C25H29F2N3O4 — CID 67907202
[1-cyclopropyl-6,8-difluoro-7-[4-(methylamino)-7-propan-2-yl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinolin-3-yl] hydrogen carbonate (PubChem CID 67907202) has the molecular formula C25H29F2N3O4 and a molecular weight of 473.52 g/mol. Its IUPAC name is [1-cyclopropyl-6,8-difluoro-7-[4-(methylamino)-7-propan-2-yl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinolin-3-yl] hydrogen carbonate.
| Compound Name | [1-cyclopropyl-6,8-difluoro-7-[4-(methylamino)-7-propan-2-yl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinolin-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67907202 |
| Molecular Formula | C25H29F2N3O4 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | [1-cyclopropyl-6,8-difluoro-7-[4-(methylamino)-7-propan-2-yl-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-4-oxoquinolin-3-yl] hydrogen carbonate |
| SMILES | CNC1C=CC(C(C)C)C2CN(c3c(F)cc4c(=O)c(OC(=O)O)cn(C5CC5)c4c3F)CC12 |
| InChI | InChI=1S/C25H29F2N3O4/c1-12(2)14-6-7-19(28-3)17-10-29(9-16(14)17)23-18(26)8-15-22(21(23)27)30(13-4-5-13)11-20(24(15)31)34-25(32)33/h6-8,11-14,16-17,19,28H,4-5,9-10H2,1-3H3,(H,32,33) |
| InChIKey | ARYNQDZTCHHWFP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|