C26H27F2N3O8 — CID 67880559
dimethyl 2-[(4aS,7aS)-6-(3-carboxyoxy-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-7-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]but-2-enedioate (PubChem CID 67880559) has the molecular formula C26H27F2N3O8 and a molecular weight of 547.51 g/mol. Its IUPAC name is dimethyl 2-[(4aS,7aS)-6-(3-carboxyoxy-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-7-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]but-2-enedioate.
| Compound Name | dimethyl 2-[(4aS,7aS)-6-(3-carboxyoxy-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-7-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]but-2-enedioate |
|---|---|
| PubChem CID | 67880559 |
| Molecular Formula | C26H27F2N3O8 |
| Molecular Weight | 547.51 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | dimethyl 2-[(4aS,7aS)-6-(3-carboxyoxy-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-7-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]but-2-enedioate |
| SMILES | COC(=O)C=C(C(=O)OC)N1CCC[C@H]2CN(c3c(F)cc4c(=O)c(OC(=O)O)cn(C5CC5)c4c3F)C[C@H]21 |
| InChI | InChI=1S/C26H27F2N3O8/c1-37-20(32)9-17(25(34)38-2)30-7-3-4-13-10-29(11-18(13)30)23-16(27)8-15-22(21(23)28)31(14-5-6-14)12-19(24(15)33)39-26(35)36/h8-9,12-14,18H,3-7,10-11H2,1-2H3,(H,35,36)/t13-,18+/m0/s1 |
| InChIKey | OOYQWQVHIVLJOH-SCLBCKFNSA-N |
| XLogP | 2.80 |
| TPSA | 127.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|