C21H25F2N3O — CID 58326177
1-cyclopropyl-6,8-difluoro-3-methyl-7-(1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)quinolin-4-one (PubChem CID 58326177) has the molecular formula C21H25F2N3O and a molecular weight of 373.45 g/mol. Its IUPAC name is 1-cyclopropyl-6,8-difluoro-3-methyl-7-(1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)quinolin-4-one.
| Compound Name | 1-cyclopropyl-6,8-difluoro-3-methyl-7-(1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)quinolin-4-one |
|---|---|
| PubChem CID | 58326177 |
| Molecular Formula | C21H25F2N3O |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-cyclopropyl-6,8-difluoro-3-methyl-7-(1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)quinolin-4-one |
| SMILES | Cc1cn(C2CC2)c2c(F)c(N3CC4CCCN(C)C4C3)c(F)cc2c1=O |
| InChI | InChI=1S/C21H25F2N3O/c1-12-9-26(14-5-6-14)19-15(21(12)27)8-16(22)20(18(19)23)25-10-13-4-3-7-24(2)17(13)11-25/h8-9,13-14,17H,3-7,10-11H2,1-2H3 |
| InChIKey | MBXIBZQPNFPAAT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |