C17H26N2O — CID 165394293
ethane;4-[(6-ethyl-1H-indol-3-yl)methyl]morpholine (PubChem CID 165394293) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is ethane;4-[(6-ethyl-1H-indol-3-yl)methyl]morpholine.
| Compound Name | ethane;4-[(6-ethyl-1H-indol-3-yl)methyl]morpholine |
|---|---|
| PubChem CID | 165394293 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | ethane;4-[(6-ethyl-1H-indol-3-yl)methyl]morpholine |
| SMILES | CC.CCc1ccc2c(CN3CCOCC3)c[nH]c2c1 |
| InChI | InChI=1S/C15H20N2O.C2H6/c1-2-12-3-4-14-13(10-16-15(14)9-12)11-17-5-7-18-8-6-17;1-2/h3-4,9-10,16H,2,5-8,11H2,1H3;1-2H3 |
| InChIKey | BQMUMKLXIULAPV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |