C14H19F3 — CID 90892155
4-butan-2-yl-1-propan-2-yl-2-(trifluoromethyl)benzene (PubChem CID 90892155) has the molecular formula C14H19F3 and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-butan-2-yl-1-propan-2-yl-2-(trifluoromethyl)benzene.
| Compound Name | 4-butan-2-yl-1-propan-2-yl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 90892155 |
| Molecular Formula | C14H19F3 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 4-butan-2-yl-1-propan-2-yl-2-(trifluoromethyl)benzene |
| SMILES | CCC(C)c1ccc(C(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3/c1-5-10(4)11-6-7-12(9(2)3)13(8-11)14(15,16)17/h6-10H,5H2,1-4H3 |
| InChIKey | ORQLSKASCNUKQI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |