C16H21F3O2 — CID 90927060
4-[4-butan-2-yl-2-(trifluoromethyl)phenoxy]oxane (PubChem CID 90927060) has the molecular formula C16H21F3O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 4-[4-butan-2-yl-2-(trifluoromethyl)phenoxy]oxane.
| Compound Name | 4-[4-butan-2-yl-2-(trifluoromethyl)phenoxy]oxane |
|---|---|
| PubChem CID | 90927060 |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-[4-butan-2-yl-2-(trifluoromethyl)phenoxy]oxane |
| SMILES | CCC(C)c1ccc(OC2CCOCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3O2/c1-3-11(2)12-4-5-15(14(10-12)16(17,18)19)21-13-6-8-20-9-7-13/h4-5,10-11,13H,3,6-9H2,1-2H3 |
| InChIKey | WLCGCOAHALBELD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |