C15H19F3O2 — CID 122470796
(2R)-1-[4-cyclopropyloxy-3-(trifluoromethyl)phenyl]-2-methylbutan-1-ol (PubChem CID 122470796) has the molecular formula C15H19F3O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is (2R)-1-[4-cyclopropyloxy-3-(trifluoromethyl)phenyl]-2-methylbutan-1-ol.
| Compound Name | (2R)-1-[4-cyclopropyloxy-3-(trifluoromethyl)phenyl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 122470796 |
| Molecular Formula | C15H19F3O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (2R)-1-[4-cyclopropyloxy-3-(trifluoromethyl)phenyl]-2-methylbutan-1-ol |
| SMILES | CC[C@@H](C)C(O)c1ccc(OC2CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3O2/c1-3-9(2)14(19)10-4-7-13(20-11-5-6-11)12(8-10)15(16,17)18/h4,7-9,11,14,19H,3,5-6H2,1-2H3/t9-,14?/m1/s1 |
| InChIKey | DWBGGBBHDNTLQE-UCWRFOARSA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |