C13H17ClO3 — CID 122470677
(2R)-1-(3-chloro-4-cyclopropyloxyphenyl)-2-methylpropane-1,3-diol (PubChem CID 122470677) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is (2R)-1-(3-chloro-4-cyclopropyloxyphenyl)-2-methylpropane-1,3-diol.
| Compound Name | (2R)-1-(3-chloro-4-cyclopropyloxyphenyl)-2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 122470677 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (2R)-1-(3-chloro-4-cyclopropyloxyphenyl)-2-methylpropane-1,3-diol |
| SMILES | C[C@H](CO)C(O)c1ccc(OC2CC2)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClO3/c1-8(7-15)13(16)9-2-5-12(11(14)6-9)17-10-3-4-10/h2,5-6,8,10,13,15-16H,3-4,7H2,1H3/t8-,13?/m1/s1 |
| InChIKey | GSRUTFBPTIWMQK-UOGPZTOASA-N |
| XLogP | 2.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |