C11H13ClO4S — CID 117443398
1-[3-chloro-4-(1,1-dioxothietan-3-yl)oxyphenyl]ethanol (PubChem CID 117443398) has the molecular formula C11H13ClO4S and a molecular weight of 276.74 g/mol. Its IUPAC name is 1-[3-chloro-4-(1,1-dioxothietan-3-yl)oxyphenyl]ethanol.
| Compound Name | 1-[3-chloro-4-(1,1-dioxothietan-3-yl)oxyphenyl]ethanol |
|---|---|
| PubChem CID | 117443398 |
| Molecular Formula | C11H13ClO4S |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 1-[3-chloro-4-(1,1-dioxothietan-3-yl)oxyphenyl]ethanol |
| SMILES | CC(O)c1ccc(OC2CS(=O)(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClO4S/c1-7(13)8-2-3-11(10(12)4-8)16-9-5-17(14,15)6-9/h2-4,7,9,13H,5-6H2,1H3 |
| InChIKey | FJPLQRGCJFIFCP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |