C12H15ClO4S — CID 64904786
(3-chloro-4-methoxyphenyl)-(1,1-dioxothiolan-3-yl)methanol (PubChem CID 64904786) has the molecular formula C12H15ClO4S and a molecular weight of 290.77 g/mol. Its IUPAC name is (3-chloro-4-methoxyphenyl)-(1,1-dioxothiolan-3-yl)methanol.
| Compound Name | (3-chloro-4-methoxyphenyl)-(1,1-dioxothiolan-3-yl)methanol |
|---|---|
| PubChem CID | 64904786 |
| Molecular Formula | C12H15ClO4S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | (3-chloro-4-methoxyphenyl)-(1,1-dioxothiolan-3-yl)methanol |
| SMILES | COc1ccc(C(O)C2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C12H15ClO4S/c1-17-11-3-2-8(6-10(11)13)12(14)9-4-5-18(15,16)7-9/h2-3,6,9,12,14H,4-5,7H2,1H3 |
| InChIKey | CRQCEFDEKSNLJP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |