C13H16BrClO4S — CID 64906024
3-[bromo-(2-chloro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide (PubChem CID 64906024) has the molecular formula C13H16BrClO4S and a molecular weight of 383.69 g/mol. Its IUPAC name is 3-[bromo-(2-chloro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide.
| Compound Name | 3-[bromo-(2-chloro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64906024 |
| Molecular Formula | C13H16BrClO4S |
| Molecular Weight | 383.69 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 3-[bromo-(2-chloro-4,5-dimethoxyphenyl)methyl]thiolane 1,1-dioxide |
| SMILES | COc1cc(Cl)c(C(Br)C2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C13H16BrClO4S/c1-18-11-5-9(10(15)6-12(11)19-2)13(14)8-3-4-20(16,17)7-8/h5-6,8,13H,3-4,7H2,1-2H3 |
| InChIKey | ASWCPHSVQVLQTC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.69 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|