C14H18Cl2O4S — CID 104521373
2-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]thiane 1,1-dioxide (PubChem CID 104521373) has the molecular formula C14H18Cl2O4S and a molecular weight of 353.27 g/mol. Its IUPAC name is 2-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104521373 |
| Molecular Formula | C14H18Cl2O4S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2-[chloro-(2-chloro-4,5-dimethoxyphenyl)methyl]thiane 1,1-dioxide |
| SMILES | COc1cc(Cl)c(C(Cl)C2CCCCS2(=O)=O)cc1OC |
| InChI | InChI=1S/C14H18Cl2O4S/c1-19-11-7-9(10(15)8-12(11)20-2)14(16)13-5-3-4-6-21(13,17)18/h7-8,13-14H,3-6H2,1-2H3 |
| InChIKey | KUZKXMDJVLUWHV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|