C14H19ClO2S — CID 104521271
2-[chloro-(3,4-dimethylphenyl)methyl]thiane 1,1-dioxide (PubChem CID 104521271) has the molecular formula C14H19ClO2S and a molecular weight of 286.82 g/mol. Its IUPAC name is 2-[chloro-(3,4-dimethylphenyl)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[chloro-(3,4-dimethylphenyl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104521271 |
| Molecular Formula | C14H19ClO2S |
| Molecular Weight | 286.82 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[chloro-(3,4-dimethylphenyl)methyl]thiane 1,1-dioxide |
| SMILES | Cc1ccc(C(Cl)C2CCCCS2(=O)=O)cc1C |
| InChI | InChI=1S/C14H19ClO2S/c1-10-6-7-12(9-11(10)2)14(15)13-5-3-4-8-18(13,16)17/h6-7,9,13-14H,3-5,8H2,1-2H3 |
| InChIKey | BPSKXZHRDSZCKH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.82 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|