C13H16BrFO2S — CID 104521652
2-[bromo-(4-fluoro-3-methylphenyl)methyl]thiane 1,1-dioxide (PubChem CID 104521652) has the molecular formula C13H16BrFO2S and a molecular weight of 335.24 g/mol. Its IUPAC name is 2-[bromo-(4-fluoro-3-methylphenyl)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[bromo-(4-fluoro-3-methylphenyl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104521652 |
| Molecular Formula | C13H16BrFO2S |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-[bromo-(4-fluoro-3-methylphenyl)methyl]thiane 1,1-dioxide |
| SMILES | Cc1cc(C(Br)C2CCCCS2(=O)=O)ccc1F |
| InChI | InChI=1S/C13H16BrFO2S/c1-9-8-10(5-6-11(9)15)13(14)12-4-2-3-7-18(12,16)17/h5-6,8,12-13H,2-4,7H2,1H3 |
| InChIKey | RLJNQJRLZPJNJL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|