C12H14BrF — CID 79746904
4-[bromo-(2-methylcyclopropyl)methyl]-1-fluoro-2-methylbenzene (PubChem CID 79746904) has the molecular formula C12H14BrF and a molecular weight of 257.15 g/mol. Its IUPAC name is 4-[bromo-(2-methylcyclopropyl)methyl]-1-fluoro-2-methylbenzene.
| Compound Name | 4-[bromo-(2-methylcyclopropyl)methyl]-1-fluoro-2-methylbenzene |
|---|---|
| PubChem CID | 79746904 |
| Molecular Formula | C12H14BrF |
| Molecular Weight | 257.15 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 4-[bromo-(2-methylcyclopropyl)methyl]-1-fluoro-2-methylbenzene |
| SMILES | Cc1cc(C(Br)C2CC2C)ccc1F |
| InChI | InChI=1S/C12H14BrF/c1-7-6-10(7)12(13)9-3-4-11(14)8(2)5-9/h3-5,7,10,12H,6H2,1-2H3 |
| InChIKey | XKRORARRBVNXER-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.15 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|