C12H13BrF2O2S — CID 104521488
2-[bromo-(3,4-difluorophenyl)methyl]thiane 1,1-dioxide (PubChem CID 104521488) has the molecular formula C12H13BrF2O2S and a molecular weight of 339.20 g/mol. Its IUPAC name is 2-[bromo-(3,4-difluorophenyl)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[bromo-(3,4-difluorophenyl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104521488 |
| Molecular Formula | C12H13BrF2O2S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 2-[bromo-(3,4-difluorophenyl)methyl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1C(Br)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H13BrF2O2S/c13-12(8-4-5-9(14)10(15)7-8)11-3-1-2-6-18(11,16)17/h4-5,7,11-12H,1-3,6H2 |
| InChIKey | QWJLALIQKJBOLF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|