C10H11Br3O2S2 — CID 104521679
2-[bromo-(4,5-dibromothiophen-2-yl)methyl]thiane 1,1-dioxide (PubChem CID 104521679) has the molecular formula C10H11Br3O2S2 and a molecular weight of 467.04 g/mol. Its IUPAC name is 2-[bromo-(4,5-dibromothiophen-2-yl)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[bromo-(4,5-dibromothiophen-2-yl)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104521679 |
| Molecular Formula | C10H11Br3O2S2 |
| Molecular Weight | 467.04 g/mol |
| Exact Mass | 463.78 |
| IUPAC Name | 2-[bromo-(4,5-dibromothiophen-2-yl)methyl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1C(Br)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H11Br3O2S2/c11-6-5-7(16-10(6)13)9(12)8-3-1-2-4-17(8,14)15/h5,8-9H,1-4H2 |
| InChIKey | XTAHZXCBUVUCAZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.04 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|