C14H15BrO2S2 — CID 104521507
2-[1-benzothiophen-3-yl(bromo)methyl]thiane 1,1-dioxide (PubChem CID 104521507) has the molecular formula C14H15BrO2S2 and a molecular weight of 359.31 g/mol. Its IUPAC name is 2-[1-benzothiophen-3-yl(bromo)methyl]thiane 1,1-dioxide.
| Compound Name | 2-[1-benzothiophen-3-yl(bromo)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104521507 |
| Molecular Formula | C14H15BrO2S2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 2-[1-benzothiophen-3-yl(bromo)methyl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1C(Br)c1csc2ccccc12 |
| InChI | InChI=1S/C14H15BrO2S2/c15-14(13-7-3-4-8-19(13,16)17)11-9-18-12-6-2-1-5-10(11)12/h1-2,5-6,9,13-14H,3-4,7-8H2 |
| InChIKey | YEYLDEZIFFFEQI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|