About 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol
1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol (PubChem CID 64906431) has the molecular formula C13H14O3S2
and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol.
Molecular Properties
| Compound Name | 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol |
| PubChem CID | 64906431 |
| Molecular Formula | C13H14O3S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol |
| SMILES | O=S1(=O)CCC(C(O)c2csc3ccccc23)C1 |
| InChI | InChI=1S/C13H14O3S2/c14-13(9-5-6-18(15,16)8-9)11-7-17-12-4-2-1-3-10(11)12/h1-4,7,9,13-14H,5-6,8H2 |
| InChIKey | RDZQOYJJIAFDBG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol?
The IUPAC name of 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol (CID 64906431) is 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol.
What is the SMILES notation for 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol?
The canonical SMILES for 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol is O=S1(=O)CCC(C(O)c2csc3ccccc23)C1.
What is the InChIKey of 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol?
The InChIKey is RDZQOYJJIAFDBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3S2/c14-13(9-5-6-18(15,16)8-9)11-7-17-12-4-2-1-3-10(11)12/h1-4,7,9,13-14H,5-6,8H2.
What are the key properties of 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol?
1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol has a molecular weight of 282.39 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzothiophen-3-yl-(1,1-dioxothiolan-3-yl)methanol is sourced from PubChem (CID 64906431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).