C14H14BrNO3S — CID 115960199
(5-bromoquinolin-8-yl)-(1,1-dioxothiolan-3-yl)methanol (PubChem CID 115960199) has the molecular formula C14H14BrNO3S and a molecular weight of 356.24 g/mol. Its IUPAC name is (5-bromoquinolin-8-yl)-(1,1-dioxothiolan-3-yl)methanol.
| Compound Name | (5-bromoquinolin-8-yl)-(1,1-dioxothiolan-3-yl)methanol |
|---|---|
| PubChem CID | 115960199 |
| Molecular Formula | C14H14BrNO3S |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | (5-bromoquinolin-8-yl)-(1,1-dioxothiolan-3-yl)methanol |
| SMILES | O=S1(=O)CCC(C(O)c2ccc(Br)c3cccnc23)C1 |
| InChI | InChI=1S/C14H14BrNO3S/c15-12-4-3-11(13-10(12)2-1-6-16-13)14(17)9-5-7-20(18,19)8-9/h1-4,6,9,14,17H,5,7-8H2 |
| InChIKey | JGFRWVXSHFVBPX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |