C11H12Br2O3S — CID 64904990
(2,5-dibromophenyl)-(1,1-dioxothiolan-3-yl)methanol (PubChem CID 64904990) has the molecular formula C11H12Br2O3S and a molecular weight of 384.09 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(1,1-dioxothiolan-3-yl)methanol.
| Compound Name | (2,5-dibromophenyl)-(1,1-dioxothiolan-3-yl)methanol |
|---|---|
| PubChem CID | 64904990 |
| Molecular Formula | C11H12Br2O3S |
| Molecular Weight | 384.09 g/mol |
| Exact Mass | 381.89 |
| IUPAC Name | (2,5-dibromophenyl)-(1,1-dioxothiolan-3-yl)methanol |
| SMILES | O=S1(=O)CCC(C(O)c2cc(Br)ccc2Br)C1 |
| InChI | InChI=1S/C11H12Br2O3S/c12-8-1-2-10(13)9(5-8)11(14)7-3-4-17(15,16)6-7/h1-2,5,7,11,14H,3-4,6H2 |
| InChIKey | DRIPTQPFEWYGAL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.09 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |